C14H18F3N — CID 143763167
(1E,4E)-2-ethenyl-3-ethylidene-N,6-dimethyl-5-(trifluoromethyl)hepta-1,4,6-trien-1-amine (PubChem CID 143763167) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is (1E,4E)-2-ethenyl-3-ethylidene-N,6-dimethyl-5-(trifluoromethyl)hepta-1,4,6-trien-1-amine.
| Compound Name | (1E,4E)-2-ethenyl-3-ethylidene-N,6-dimethyl-5-(trifluoromethyl)hepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143763167 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (1E,4E)-2-ethenyl-3-ethylidene-N,6-dimethyl-5-(trifluoromethyl)hepta-1,4,6-trien-1-amine |
| SMILES | C=C/C(=C\NC)C(=CC)/C=C(\C(=C)C)C(F)(F)F |
| InChI | InChI=1S/C14H18F3N/c1-6-11(12(7-2)9-18-5)8-13(10(3)4)14(15,16)17/h6-9,18H,2-3H2,1,4-5H3/b11-6?,12-9+,13-8+ |
| InChIKey | BVXQFBMJRAEVAW-HJPPIFJPSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|