C11H14F3NO — CID 143763160
N-[(4E)-6-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]acetamide (PubChem CID 143763160) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is N-[(4E)-6-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]acetamide.
| Compound Name | N-[(4E)-6-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]acetamide |
|---|---|
| PubChem CID | 143763160 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-[(4E)-6-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]acetamide |
| SMILES | C=C(C)/C(=C\C(=CC)NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO/c1-5-9(15-8(4)16)6-10(7(2)3)11(12,13)14/h5-6H,2H2,1,3-4H3,(H,15,16)/b9-5?,10-6+ |
| InChIKey | KFPCJIDEPKNXPI-HYAZYBELSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|