About N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide
N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide (PubChem CID 144714504) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide |
| PubChem CID | 144714504 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(/C=C\CC)=C/C |
| InChI | InChI=1S/C11H17NO/c1-5-7-8-10(6-2)12-11(13)9(3)4/h6-8H,3,5H2,1-2,4H3,(H,12,13)/b8-7-,10-6+ |
| InChIKey | VNIOLGVTCAGOBB-SDHBEMGISA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide?
The IUPAC name of N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide (CID 144714504) is N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide.
What is the SMILES notation for N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide?
The canonical SMILES for N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide is C=C(C)C(=O)NC(/C=C\CC)=C/C.
What is the InChIKey of N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide?
The InChIKey is VNIOLGVTCAGOBB-SDHBEMGISA-N. The full InChI is InChI=1S/C11H17NO/c1-5-7-8-10(6-2)12-11(13)9(3)4/h6-8H,3,5H2,1-2,4H3,(H,12,13)/b8-7-,10-6+.
What are the key properties of N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide?
N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide has a molecular weight of 179.26 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylprop-2-enamide is sourced from PubChem (CID 144714504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).