C10H15NO2 — CID 163760417
(E,2Z)-N-acetyl-2-ethylidenehex-3-enamide (PubChem CID 163760417) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (E,2Z)-N-acetyl-2-ethylidenehex-3-enamide.
| Compound Name | (E,2Z)-N-acetyl-2-ethylidenehex-3-enamide |
|---|---|
| PubChem CID | 163760417 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (E,2Z)-N-acetyl-2-ethylidenehex-3-enamide |
| SMILES | C/C=C(/C=C/CC)C(=O)NC(C)=O |
| InChI | InChI=1S/C10H15NO2/c1-4-6-7-9(5-2)10(13)11-8(3)12/h5-7H,4H2,1-3H3,(H,11,12,13)/b7-6+,9-5- |
| InChIKey | LXSHRKZPEXRDNV-MTNQHGNXSA-N |
| XLogP | 1.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|