C11H21NO — CID 143775186
ethane;N-[(2Z,4E)-hepta-2,4-dien-4-yl]acetamide (PubChem CID 143775186) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is ethane;N-[(2Z,4E)-hepta-2,4-dien-4-yl]acetamide.
| Compound Name | ethane;N-[(2Z,4E)-hepta-2,4-dien-4-yl]acetamide |
|---|---|
| PubChem CID | 143775186 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | ethane;N-[(2Z,4E)-hepta-2,4-dien-4-yl]acetamide |
| SMILES | C/C=C\C(=C/CC)NC(C)=O.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-4-6-9(7-5-2)10-8(3)11;1-2/h4,6-7H,5H2,1-3H3,(H,10,11);1-2H3/b6-4-,9-7+; |
| InChIKey | GZBLCNWPFVJURZ-DZJVOSCXSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|