C18H31NO — CID 143942384
N-[(2Z,4E)-hepta-2,4-dien-4-yl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 143942384) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is N-[(2Z,4E)-hepta-2,4-dien-4-yl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-[(2Z,4E)-hepta-2,4-dien-4-yl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 143942384 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | N-[(2Z,4E)-hepta-2,4-dien-4-yl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | C/C=C\C(=C/CC)NC(=O)C1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C18H31NO/c1-6-8-15(9-7-2)19-18(20)17-12-14(5)10-11-16(17)13(3)4/h6,8-9,13-14,16-17H,7,10-12H2,1-5H3,(H,19,20)/b8-6-,15-9+ |
| InChIKey | ZCTFSJLOMMVQEB-ROYGEPAJSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|