C8H12ClNO — CID 142119428
N-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]acetamide (PubChem CID 142119428) has the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. Its IUPAC name is N-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]acetamide.
| Compound Name | N-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 142119428 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | N-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]acetamide |
| SMILES | C/C=C(\C=C/CCl)NC(C)=O |
| InChI | InChI=1S/C8H12ClNO/c1-3-8(5-4-6-9)10-7(2)11/h3-5H,6H2,1-2H3,(H,10,11)/b5-4-,8-3+ |
| InChIKey | RAEJSJPLHJWQAJ-UEQFWHKLSA-N |
| XLogP | 1.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|