About (6-chloro-3-methylhexa-2,4-dienyl) acetate
(6-chloro-3-methylhexa-2,4-dienyl) acetate (PubChem CID 156769956) has the molecular formula C9H13ClO2
and a molecular weight of 188.65 g/mol. Its IUPAC name is (6-chloro-3-methylhexa-2,4-dienyl) acetate.
Molecular Properties
| Compound Name | (6-chloro-3-methylhexa-2,4-dienyl) acetate |
| PubChem CID | 156769956 |
| Molecular Formula | C9H13ClO2 |
| Molecular Weight | 188.65 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (6-chloro-3-methylhexa-2,4-dienyl) acetate |
| SMILES | CC(=O)OCC=C(C)C=CCCl |
| InChI | InChI=1S/C9H13ClO2/c1-8(4-3-6-10)5-7-12-9(2)11/h3-5H,6-7H2,1-2H3 |
| InChIKey | LMFJKQXAHZGLPL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.65 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-3-methylhexa-2,4-dienyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3-methylhexa-2,4-dienyl) acetate?
The IUPAC name of (6-chloro-3-methylhexa-2,4-dienyl) acetate (CID 156769956) is (6-chloro-3-methylhexa-2,4-dienyl) acetate.
What is the SMILES notation for (6-chloro-3-methylhexa-2,4-dienyl) acetate?
The canonical SMILES for (6-chloro-3-methylhexa-2,4-dienyl) acetate is CC(=O)OCC=C(C)C=CCCl.
What is the InChIKey of (6-chloro-3-methylhexa-2,4-dienyl) acetate?
The InChIKey is LMFJKQXAHZGLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClO2/c1-8(4-3-6-10)5-7-12-9(2)11/h3-5H,6-7H2,1-2H3.
What are the key properties of (6-chloro-3-methylhexa-2,4-dienyl) acetate?
(6-chloro-3-methylhexa-2,4-dienyl) acetate has a molecular weight of 188.65 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3-methylhexa-2,4-dienyl) acetate is sourced from PubChem (CID 156769956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).