C7H11ClO — CID 126763646
(4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol (PubChem CID 126763646) has the molecular formula C7H11ClO and a molecular weight of 146.62 g/mol. Its IUPAC name is (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol.
| Compound Name | (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol |
|---|---|
| PubChem CID | 126763646 |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol |
| SMILES | CC(C)=C(O)/C=C\CCl |
| InChI | InChI=1S/C7H11ClO/c1-6(2)7(9)4-3-5-8/h3-4,9H,5H2,1-2H3/b4-3- |
| InChIKey | MKDZLFSNLFAHQR-ARJAWSKDSA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|