About (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol
(4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol (PubChem CID 126763646) has the molecular formula C7H11ClO
and a molecular weight of 146.62 g/mol. Its IUPAC name is (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol.
Molecular Properties
| Compound Name | (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol |
| PubChem CID | 126763646 |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol |
| SMILES | CC(C)=C(O)/C=C\CCl |
| InChI | InChI=1S/C7H11ClO/c1-6(2)7(9)4-3-5-8/h3-4,9H,5H2,1-2H3/b4-3- |
| InChIKey | MKDZLFSNLFAHQR-ARJAWSKDSA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol?
The IUPAC name of (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol (CID 126763646) is (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol.
What is the SMILES notation for (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol?
The canonical SMILES for (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol is CC(C)=C(O)/C=C\CCl.
What is the InChIKey of (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol?
The InChIKey is MKDZLFSNLFAHQR-ARJAWSKDSA-N. The full InChI is InChI=1S/C7H11ClO/c1-6(2)7(9)4-3-5-8/h3-4,9H,5H2,1-2H3/b4-3-.
What are the key properties of (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol?
(4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol has a molecular weight of 146.62 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-6-chloro-2-methylhexa-2,4-dien-3-ol is sourced from PubChem (CID 126763646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).