C10H10Cl4O — CID 139662029
2,5-dichloro-1-(2,5-dichloropenta-1,3-dienoxy)penta-1,3-diene (PubChem CID 139662029) has the molecular formula C10H10Cl4O and a molecular weight of 288.00 g/mol. Its IUPAC name is 2,5-dichloro-1-(2,5-dichloropenta-1,3-dienoxy)penta-1,3-diene.
| Compound Name | 2,5-dichloro-1-(2,5-dichloropenta-1,3-dienoxy)penta-1,3-diene |
|---|---|
| PubChem CID | 139662029 |
| Molecular Formula | C10H10Cl4O |
| Molecular Weight | 288.00 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 2,5-dichloro-1-(2,5-dichloropenta-1,3-dienoxy)penta-1,3-diene |
| SMILES | ClCC=CC(Cl)=COC=C(Cl)C=CCCl |
| InChI | InChI=1S/C10H10Cl4O/c11-5-1-3-9(13)7-15-8-10(14)4-2-6-12/h1-4,7-8H,5-6H2 |
| InChIKey | YVFVXQHFLROYFZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.00 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|