C7H9ClFN — CID 170368180
(3E,5Z)-7-chloro-2-fluorohepta-1,3,5-trien-4-amine (PubChem CID 170368180) has the molecular formula C7H9ClFN and a molecular weight of 161.61 g/mol. Its IUPAC name is (3E,5Z)-7-chloro-2-fluorohepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-7-chloro-2-fluorohepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 170368180 |
| Molecular Formula | C7H9ClFN |
| Molecular Weight | 161.61 g/mol |
| Exact Mass | 161.04 |
| IUPAC Name | (3E,5Z)-7-chloro-2-fluorohepta-1,3,5-trien-4-amine |
| SMILES | C=C(F)/C=C(N)\C=C/CCl |
| InChI | InChI=1S/C7H9ClFN/c1-6(9)5-7(10)3-2-4-8/h2-3,5H,1,4,10H2/b3-2-,7-5+ |
| InChIKey | IQLUENVHUKBRKY-JYUXVSJCSA-N |
| XLogP | 2.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.61 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|