C5H7FO — CID 147076442
(2Z)-4-fluoropenta-2,4-dien-1-ol (PubChem CID 147076442) has the molecular formula C5H7FO and a molecular weight of 102.11 g/mol. Its IUPAC name is (2Z)-4-fluoropenta-2,4-dien-1-ol.
| Compound Name | (2Z)-4-fluoropenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 147076442 |
| Molecular Formula | C5H7FO |
| Molecular Weight | 102.11 g/mol |
| Exact Mass | 102.05 |
| IUPAC Name | (2Z)-4-fluoropenta-2,4-dien-1-ol |
| SMILES | C=C(F)/C=C\CO |
| InChI | InChI=1S/C5H7FO/c1-5(6)3-2-4-7/h2-3,7H,1,4H2/b3-2- |
| InChIKey | BGBBOIOVZCHEEI-IHWYPQMZSA-N |
| XLogP | 1.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.11 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|