C5H6F2O — CID 162537036
5,5-difluoropenta-2,4-dien-1-ol (PubChem CID 162537036) has the molecular formula C5H6F2O and a molecular weight of 120.10 g/mol. Its IUPAC name is 5,5-difluoropenta-2,4-dien-1-ol.
| Compound Name | 5,5-difluoropenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 162537036 |
| Molecular Formula | C5H6F2O |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 5,5-difluoropenta-2,4-dien-1-ol |
| SMILES | OCC=CC=C(F)F |
| InChI | InChI=1S/C5H6F2O/c6-5(7)3-1-2-4-8/h1-3,8H,4H2 |
| InChIKey | KVGXIIKALMFAJK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.10 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|