C17H34OSn — CID 172715105
(2Z,4E)-5-tributylstannylpenta-2,4-dien-1-ol (PubChem CID 172715105) has the molecular formula C17H34OSn and a molecular weight of 373.17 g/mol. Its IUPAC name is (2Z,4E)-5-tributylstannylpenta-2,4-dien-1-ol.
| Compound Name | (2Z,4E)-5-tributylstannylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 172715105 |
| Molecular Formula | C17H34OSn |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2Z,4E)-5-tributylstannylpenta-2,4-dien-1-ol |
| SMILES | CCCC[Sn](/C=C/C=C\CO)(CCCC)CCCC |
| InChI | InChI=1S/C5H7O.3C4H9.Sn/c1-2-3-4-5-6;3*1-3-4-2;/h1-4,6H,5H2;3*1,3-4H2,2H3;/b2-1?,4-3-;;;; |
| InChIKey | FTIASHUFEMBAFZ-BFDKIIGWSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|