C21H44OSn — CID 173361577
(4S)-4-methyl-1-tributylstannyloct-1-en-4-ol (PubChem CID 173361577) has the molecular formula C21H44OSn and a molecular weight of 431.29 g/mol. Its IUPAC name is (4S)-4-methyl-1-tributylstannyloct-1-en-4-ol.
| Compound Name | (4S)-4-methyl-1-tributylstannyloct-1-en-4-ol |
|---|---|
| PubChem CID | 173361577 |
| Molecular Formula | C21H44OSn |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (4S)-4-methyl-1-tributylstannyloct-1-en-4-ol |
| SMILES | CCCC[C@](C)(O)CC=C[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C9H17O.3C4H9.Sn/c1-4-6-8-9(3,10)7-5-2;3*1-3-4-2;/h2,5,10H,4,6-8H2,1,3H3;3*1,3-4H2,2H3;/t9-;;;;/m1..../s1 |
| InChIKey | MEHZQZSWAWWYIC-RASHCQHBSA-N |
| XLogP | 7.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |