C24H50OSiSn — CID 23331458
trimethyl-[(1E,5E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane (PubChem CID 23331458) has the molecular formula C24H50OSiSn and a molecular weight of 501.46 g/mol. Its IUPAC name is trimethyl-[(1E,5E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane.
| Compound Name | trimethyl-[(1E,5E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane |
|---|---|
| PubChem CID | 23331458 |
| Molecular Formula | C24H50OSiSn |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | trimethyl-[(1E,5E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane |
| SMILES | CC/C=C/C(C)(C/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C12H23OSi.3C4H9.Sn/c1-7-9-11-12(3,10-8-2)13-14(4,5)6;3*1-3-4-2;/h2,8-9,11H,7,10H2,1,3-6H3;3*1,3-4H2,2H3;/b8-2?,11-9+;;;; |
| InChIKey | FRDITKXHELLQPT-UCQJVCOSSA-N |
| XLogP | 8.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|