C20H42O2Sn — CID 10574786
tributyl-[(E)-4,4-diethoxybut-1-enyl]stannane (PubChem CID 10574786) has the molecular formula C20H42O2Sn and a molecular weight of 433.27 g/mol. Its IUPAC name is tributyl-[(E)-4,4-diethoxybut-1-enyl]stannane.
| Compound Name | tributyl-[(E)-4,4-diethoxybut-1-enyl]stannane |
|---|---|
| PubChem CID | 10574786 |
| Molecular Formula | C20H42O2Sn |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | tributyl-[(E)-4,4-diethoxybut-1-enyl]stannane |
| SMILES | CCCC[Sn](/C=C/CC(OCC)OCC)(CCCC)CCCC |
| InChI | InChI=1S/C8H15O2.3C4H9.Sn/c1-4-7-8(9-5-2)10-6-3;3*1-3-4-2;/h1,4,8H,5-7H2,2-3H3;3*1,3-4H2,2H3; |
| InChIKey | QYPYRVLOOGTSIG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|