C19H40O2Sn — CID 14592139
tributyl-[(Z)-3,3-diethoxyprop-1-enyl]stannane (PubChem CID 14592139) has the molecular formula C19H40O2Sn and a molecular weight of 419.24 g/mol. Its IUPAC name is tributyl-[(Z)-3,3-diethoxyprop-1-enyl]stannane.
| Compound Name | tributyl-[(Z)-3,3-diethoxyprop-1-enyl]stannane |
|---|---|
| PubChem CID | 14592139 |
| Molecular Formula | C19H40O2Sn |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | tributyl-[(Z)-3,3-diethoxyprop-1-enyl]stannane |
| SMILES | CCCC[Sn](/C=C\C(OCC)OCC)(CCCC)CCCC |
| InChI | InChI=1S/C7H13O2.3C4H9.Sn/c1-4-7(8-5-2)9-6-3;3*1-3-4-2;/h1,4,7H,5-6H2,2-3H3;3*1,3-4H2,2H3; |
| InChIKey | XSQKHHCSNRVBRP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|