methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate

C19H38O2Sn — CID 139263828

IUPACmethyl (Z)-3-methyl-5-tributylstannylpent-4-enoate
SMILESCCCC[Sn](/C=C\C(C)CC(=O)OC)(CCCC)CCCC
InChIInChI=1S/C7H11O2.3C4H9.Sn/c1-4-6(2)5-7(8)9-3;3*1-3-4-2;/h1,4,6H,5H2,2-3H3;3*1,3-4H2,2H3;
InChIKeyPMOLYKWDSBZAKO-UHFFFAOYSA-N
MW417.22 g/mol
LogP6.13
Rot. Bonds13

About methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate

methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate (PubChem CID 139263828) has the molecular formula C19H38O2Sn and a molecular weight of 417.22 g/mol. Its IUPAC name is methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate.

Molecular Properties

Compound Namemethyl (Z)-3-methyl-5-tributylstannylpent-4-enoate
PubChem CID139263828
Molecular FormulaC19H38O2Sn
Molecular Weight417.22 g/mol
Exact Mass418.19
IUPAC Namemethyl (Z)-3-methyl-5-tributylstannylpent-4-enoate
SMILESCCCC[Sn](/C=C\C(C)CC(=O)OC)(CCCC)CCCC
InChIInChI=1S/C7H11O2.3C4H9.Sn/c1-4-6(2)5-7(8)9-3;3*1-3-4-2;/h1,4,6H,5H2,2-3H3;3*1,3-4H2,2H3;
InChIKeyPMOLYKWDSBZAKO-UHFFFAOYSA-N
XLogP6.13
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds13
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500417.22
LogP ≤ 56.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate?
The IUPAC name of methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate (CID 139263828) is methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate.
What is the SMILES notation for methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate?
The canonical SMILES for methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate is CCCC[Sn](/C=C\C(C)CC(=O)OC)(CCCC)CCCC.
What is the InChIKey of methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate?
The InChIKey is PMOLYKWDSBZAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11O2.3C4H9.Sn/c1-4-6(2)5-7(8)9-3;3*1-3-4-2;/h1,4,6H,5H2,2-3H3;3*1,3-4H2,2H3;.
What are the key properties of methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate?
methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate has a molecular weight of 417.22 g/mol, XLogP of 6.13, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate is sourced from PubChem (CID 139263828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).