C19H38O2Sn — CID 139263828
methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate (PubChem CID 139263828) has the molecular formula C19H38O2Sn and a molecular weight of 417.22 g/mol. Its IUPAC name is methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate.
| Compound Name | methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate |
|---|---|
| PubChem CID | 139263828 |
| Molecular Formula | C19H38O2Sn |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | methyl (Z)-3-methyl-5-tributylstannylpent-4-enoate |
| SMILES | CCCC[Sn](/C=C\C(C)CC(=O)OC)(CCCC)CCCC |
| InChI | InChI=1S/C7H11O2.3C4H9.Sn/c1-4-6(2)5-7(8)9-3;3*1-3-4-2;/h1,4,6H,5H2,2-3H3;3*1,3-4H2,2H3; |
| InChIKey | PMOLYKWDSBZAKO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |