C26H50Sn — CID 50993250
tributyl-[(1E,3R,5E,7E,9S)-3,5,9-trimethylundeca-1,5,7-trienyl]stannane (PubChem CID 50993250) has the molecular formula C26H50Sn and a molecular weight of 481.40 g/mol. Its IUPAC name is tributyl-[(1E,3R,5E,7E,9S)-3,5,9-trimethylundeca-1,5,7-trienyl]stannane.
| Compound Name | tributyl-[(1E,3R,5E,7E,9S)-3,5,9-trimethylundeca-1,5,7-trienyl]stannane |
|---|---|
| PubChem CID | 50993250 |
| Molecular Formula | C26H50Sn |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | tributyl-[(1E,3R,5E,7E,9S)-3,5,9-trimethylundeca-1,5,7-trienyl]stannane |
| SMILES | CCCC[Sn](/C=C/[C@H](C)C/C(C)=C/C=C/[C@@H](C)CC)(CCCC)CCCC |
| InChI | InChI=1S/C14H23.3C4H9.Sn/c1-6-12(3)9-8-10-14(5)11-13(4)7-2;3*1-3-4-2;/h2,7-10,12-13H,6,11H2,1,3-5H3;3*1,3-4H2,2H3;/b7-2?,9-8+,14-10+;;;;/t12-,13-;;;;/m0..../s1 |
| InChIKey | FWPQXZRXRVXXCH-DDADMKEWSA-N |
| XLogP | 9.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|