C18H35BrSn — CID 15675034
[(1E,3E)-5-bromo-4-methylpenta-1,3-dienyl]-tributylstannane (PubChem CID 15675034) has the molecular formula C18H35BrSn and a molecular weight of 450.09 g/mol. Its IUPAC name is [(1E,3E)-5-bromo-4-methylpenta-1,3-dienyl]-tributylstannane.
| Compound Name | [(1E,3E)-5-bromo-4-methylpenta-1,3-dienyl]-tributylstannane |
|---|---|
| PubChem CID | 15675034 |
| Molecular Formula | C18H35BrSn |
| Molecular Weight | 450.09 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | [(1E,3E)-5-bromo-4-methylpenta-1,3-dienyl]-tributylstannane |
| SMILES | CCCC[Sn](/C=C/C=C(\C)CBr)(CCCC)CCCC |
| InChI | InChI=1S/C6H8Br.3C4H9.Sn/c1-3-4-6(2)5-7;3*1-3-4-2;/h1,3-4H,5H2,2H3;3*1,3-4H2,2H3;/b3-1?,6-4+;;;; |
| InChIKey | FNRLQHZHICVNIU-JFMQTAQSSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.09 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|