C18H36OSn — CID 71342873
2-methyl-5-tributylstannylpenta-2,4-dien-1-ol (PubChem CID 71342873) has the molecular formula C18H36OSn and a molecular weight of 387.20 g/mol. Its IUPAC name is 2-methyl-5-tributylstannylpenta-2,4-dien-1-ol.
| Compound Name | 2-methyl-5-tributylstannylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 71342873 |
| Molecular Formula | C18H36OSn |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-methyl-5-tributylstannylpenta-2,4-dien-1-ol |
| SMILES | CCCC[Sn](C=CC=C(C)CO)(CCCC)CCCC |
| InChI | InChI=1S/C6H9O.3C4H9.Sn/c1-3-4-6(2)5-7;3*1-3-4-2;/h1,3-4,7H,5H2,2H3;3*1,3-4H2,2H3; |
| InChIKey | AAZOPNWQKZHFPM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|