C18H36OSn — CID 10960038
tributyl-[(1E,3E)-4-ethoxybuta-1,3-dienyl]stannane (PubChem CID 10960038) has the molecular formula C18H36OSn and a molecular weight of 387.20 g/mol. Its IUPAC name is tributyl-[(1E,3E)-4-ethoxybuta-1,3-dienyl]stannane.
| Compound Name | tributyl-[(1E,3E)-4-ethoxybuta-1,3-dienyl]stannane |
|---|---|
| PubChem CID | 10960038 |
| Molecular Formula | C18H36OSn |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | tributyl-[(1E,3E)-4-ethoxybuta-1,3-dienyl]stannane |
| SMILES | CCCC[Sn](/C=C/C=C/OCC)(CCCC)CCCC |
| InChI | InChI=1S/C6H9O.3C4H9.Sn/c1-3-5-6-7-4-2;3*1-3-4-2;/h1,3,5-6H,4H2,2H3;3*1,3-4H2,2H3;/b3-1?,6-5+;;;; |
| InChIKey | QPTIHENSULSOEH-POUKTLFDSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|