C19H36O2Sn — CID 71358263
tributyl-[4-(1,3-dioxolan-2-yl)buta-1,3-dienyl]stannane (PubChem CID 71358263) has the molecular formula C19H36O2Sn and a molecular weight of 415.21 g/mol. Its IUPAC name is tributyl-[4-(1,3-dioxolan-2-yl)buta-1,3-dienyl]stannane.
| Compound Name | tributyl-[4-(1,3-dioxolan-2-yl)buta-1,3-dienyl]stannane |
|---|---|
| PubChem CID | 71358263 |
| Molecular Formula | C19H36O2Sn |
| Molecular Weight | 415.21 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | tributyl-[4-(1,3-dioxolan-2-yl)buta-1,3-dienyl]stannane |
| SMILES | CCCC[Sn](C=CC=CC1OCCO1)(CCCC)CCCC |
| InChI | InChI=1S/C7H9O2.3C4H9.Sn/c1-2-3-4-7-8-5-6-9-7;3*1-3-4-2;/h1-4,7H,5-6H2;3*1,3-4H2,2H3; |
| InChIKey | MYVSVXURMCAMFQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.21 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|