C18H36Sn — CID 11257245
tributyl-[(1E)-4-methylpenta-1,4-dienyl]stannane (PubChem CID 11257245) has the molecular formula C18H36Sn and a molecular weight of 371.20 g/mol. Its IUPAC name is tributyl-[(1E)-4-methylpenta-1,4-dienyl]stannane.
| Compound Name | tributyl-[(1E)-4-methylpenta-1,4-dienyl]stannane |
|---|---|
| PubChem CID | 11257245 |
| Molecular Formula | C18H36Sn |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | tributyl-[(1E)-4-methylpenta-1,4-dienyl]stannane |
| SMILES | C=C(C)C/C=C/[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C6H9.3C4H9.Sn/c1-4-5-6(2)3;3*1-3-4-2;/h1,4H,2,5H2,3H3;3*1,3-4H2,2H3; |
| InChIKey | ZYGGCRAHNBUOFD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|