C17H35NOSn — CID 19785799
(E)-N,N-dimethyl-3-tributylstannylprop-2-enamide (PubChem CID 19785799) has the molecular formula C17H35NOSn and a molecular weight of 388.18 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-tributylstannylprop-2-enamide.
| Compound Name | (E)-N,N-dimethyl-3-tributylstannylprop-2-enamide |
|---|---|
| PubChem CID | 19785799 |
| Molecular Formula | C17H35NOSn |
| Molecular Weight | 388.18 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (E)-N,N-dimethyl-3-tributylstannylprop-2-enamide |
| SMILES | CCCC[Sn](/C=C/C(=O)N(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C5H8NO.3C4H9.Sn/c1-4-5(7)6(2)3;3*1-3-4-2;/h1,4H,2-3H3;3*1,3-4H2,2H3; |
| InChIKey | YYHQFGKSJTWJQX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.18 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|