C28H54O2SiSn — CID 11766953
tri(propan-2-yl)silyl (2E,4E,6E)-7-tributylstannylhepta-2,4,6-trienoate (PubChem CID 11766953) has the molecular formula C28H54O2SiSn and a molecular weight of 569.54 g/mol. Its IUPAC name is tri(propan-2-yl)silyl (2E,4E,6E)-7-tributylstannylhepta-2,4,6-trienoate.
| Compound Name | tri(propan-2-yl)silyl (2E,4E,6E)-7-tributylstannylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 11766953 |
| Molecular Formula | C28H54O2SiSn |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | tri(propan-2-yl)silyl (2E,4E,6E)-7-tributylstannylhepta-2,4,6-trienoate |
| SMILES | CCCC[Sn](/C=C/C=C/C=C/C(=O)O[Si](C(C)C)(C(C)C)C(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C16H27O2Si.3C4H9.Sn/c1-8-9-10-11-12-16(17)18-19(13(2)3,14(4)5)15(6)7;3*1-3-4-2;/h1,8-15H,2-7H3;3*1,3-4H2,2H3;/b8-1?,10-9+,12-11+;;;; |
| InChIKey | YWUPLMRIXYECFU-OWUJWTGBSA-N |
| XLogP | 9.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|