C41H80O3Si2Sn — CID 53306024
(E,1S,2S)-1-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]-2-methyl-4-tributylstannylbut-3-en-1-ol (PubChem CID 53306024) has the molecular formula C41H80O3Si2Sn and a molecular weight of 795.97 g/mol. Its IUPAC name is (E,1S,2S)-1-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]-2-methyl-4-tributylstannylbut-3-en-1-ol.
| Compound Name | (E,1S,2S)-1-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]-2-methyl-4-tributylstannylbut-3-en-1-ol |
|---|---|
| PubChem CID | 53306024 |
| Molecular Formula | C41H80O3Si2Sn |
| Molecular Weight | 795.97 g/mol |
| Exact Mass | 796.47 |
| IUPAC Name | (E,1S,2S)-1-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]-2-methyl-4-tributylstannylbut-3-en-1-ol |
| SMILES | CCCC[Sn](/C=C/[C@H](C)[C@H](O)c1cc(O[Si](C(C)C)(C(C)C)C(C)C)cc(O[Si](C(C)C)(C(C)C)C(C)C)c1)(CCCC)CCCC |
| InChI | InChI=1S/C29H53O3Si2.3C4H9.Sn/c1-15-25(14)29(30)26-16-27(31-33(19(2)3,20(4)5)21(6)7)18-28(17-26)32-34(22(8)9,23(10)11)24(12)13;3*1-3-4-2;/h1,15-25,29-30H,2-14H3;3*1,3-4H2,2H3;/t25-,29-;;;;/m0..../s1 |
| InChIKey | MPQGQEOGJDWVLP-SKQLUAGVSA-N |
| XLogP | 14.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.97 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|