C22H39NO4Si — CID 69108234
[1-hydroxy-3,3-dimethyl-1-[3-tri(propan-2-yl)silyloxyphenyl]butan-2-yl]carbamic acid (PubChem CID 69108234) has the molecular formula C22H39NO4Si and a molecular weight of 409.64 g/mol. Its IUPAC name is [1-hydroxy-3,3-dimethyl-1-[3-tri(propan-2-yl)silyloxyphenyl]butan-2-yl]carbamic acid.
| Compound Name | [1-hydroxy-3,3-dimethyl-1-[3-tri(propan-2-yl)silyloxyphenyl]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69108234 |
| Molecular Formula | C22H39NO4Si |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | [1-hydroxy-3,3-dimethyl-1-[3-tri(propan-2-yl)silyloxyphenyl]butan-2-yl]carbamic acid |
| SMILES | CC(C)[Si](Oc1cccc(C(O)C(NC(=O)O)C(C)(C)C)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H39NO4Si/c1-14(2)28(15(3)4,16(5)6)27-18-12-10-11-17(13-18)19(24)20(22(7,8)9)23-21(25)26/h10-16,19-20,23-24H,1-9H3,(H,25,26) |
| InChIKey | RVRZOZMIIGCAGG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|