C27H44OSn — CID 50993196
(4E,6E,8E)-1-phenyl-9-tributylstannylnona-4,6,8-trien-3-ol (PubChem CID 50993196) has the molecular formula C27H44OSn and a molecular weight of 503.36 g/mol. Its IUPAC name is (4E,6E,8E)-1-phenyl-9-tributylstannylnona-4,6,8-trien-3-ol.
| Compound Name | (4E,6E,8E)-1-phenyl-9-tributylstannylnona-4,6,8-trien-3-ol |
|---|---|
| PubChem CID | 50993196 |
| Molecular Formula | C27H44OSn |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | (4E,6E,8E)-1-phenyl-9-tributylstannylnona-4,6,8-trien-3-ol |
| SMILES | CCCC[Sn](/C=C/C=C/C=C/C(O)CCc1ccccc1)(CCCC)CCCC |
| InChI | InChI=1S/C15H17O.3C4H9.Sn/c1-2-3-4-8-11-15(16)13-12-14-9-6-5-7-10-14;3*1-3-4-2;/h1-11,15-16H,12-13H2;3*1,3-4H2,2H3;/b2-1?,4-3+,11-8+;;;; |
| InChIKey | ARSVGOGMCSURAU-PLCBHPDLSA-N |
| XLogP | 8.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|