C29H54OSiSn — CID 67429705
triethyl-[(E,3S)-5-phenyl-1-tributylstannylpent-1-en-3-yl]oxysilane (PubChem CID 67429705) has the molecular formula C29H54OSiSn and a molecular weight of 565.55 g/mol. Its IUPAC name is triethyl-[(E,3S)-5-phenyl-1-tributylstannylpent-1-en-3-yl]oxysilane.
| Compound Name | triethyl-[(E,3S)-5-phenyl-1-tributylstannylpent-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 67429705 |
| Molecular Formula | C29H54OSiSn |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | triethyl-[(E,3S)-5-phenyl-1-tributylstannylpent-1-en-3-yl]oxysilane |
| SMILES | CCCC[Sn](/C=C/[C@H](CCc1ccccc1)O[Si](CC)(CC)CC)(CCCC)CCCC |
| InChI | InChI=1S/C17H27OSi.3C4H9.Sn/c1-5-17(18-19(6-2,7-3)8-4)15-14-16-12-10-9-11-13-16;3*1-3-4-2;/h1,5,9-13,17H,6-8,14-15H2,2-4H3;3*1,3-4H2,2H3;/t17-;;;;/m1..../s1 |
| InChIKey | CNAIWMQITWTFSL-GIZSFIMASA-N |
| XLogP | 9.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|