C21H34O3Si — CID 101407480
(E,5S,6R)-6-methyl-8-phenyl-5-triethylsilyloxyoct-2-enoic acid (PubChem CID 101407480) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is (E,5S,6R)-6-methyl-8-phenyl-5-triethylsilyloxyoct-2-enoic acid.
| Compound Name | (E,5S,6R)-6-methyl-8-phenyl-5-triethylsilyloxyoct-2-enoic acid |
|---|---|
| PubChem CID | 101407480 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (E,5S,6R)-6-methyl-8-phenyl-5-triethylsilyloxyoct-2-enoic acid |
| SMILES | CC[Si](CC)(CC)O[C@@H](C/C=C/C(=O)O)[C@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C21H34O3Si/c1-5-25(6-2,7-3)24-20(14-11-15-21(22)23)18(4)16-17-19-12-9-8-10-13-19/h8-13,15,18,20H,5-7,14,16-17H2,1-4H3,(H,22,23)/b15-11+/t18-,20+/m1/s1 |
| InChIKey | ZFMRGYVQKNHTFJ-JAGYYFLNSA-N |
| XLogP | 5.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|