C34H74O3Si2Sn — CID 11468178
(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-7-tributylstannyl-5-tri(propan-2-yl)silyloxyhept-6-en-1-ol (PubChem CID 11468178) has the molecular formula C34H74O3Si2Sn and a molecular weight of 705.85 g/mol. Its IUPAC name is (E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-7-tributylstannyl-5-tri(propan-2-yl)silyloxyhept-6-en-1-ol.
| Compound Name | (E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-7-tributylstannyl-5-tri(propan-2-yl)silyloxyhept-6-en-1-ol |
|---|---|
| PubChem CID | 11468178 |
| Molecular Formula | C34H74O3Si2Sn |
| Molecular Weight | 705.85 g/mol |
| Exact Mass | 706.42 |
| IUPAC Name | (E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-7-tributylstannyl-5-tri(propan-2-yl)silyloxyhept-6-en-1-ol |
| SMILES | CCCC[Sn](/C=C/[C@H](C[C@H](CCO)O[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C22H47O3Si2.3C4H9.Sn/c1-13-20(25-27(17(2)3,18(4)5)19(6)7)16-21(14-15-23)24-26(11,12)22(8,9)10;3*1-3-4-2;/h1,13,17-21,23H,14-16H2,2-12H3;3*1,3-4H2,2H3;/t20-,21+;;;;/m1..../s1 |
| InChIKey | CHNFACUFQCUFJV-WURRAPDFSA-N |
| XLogP | 11.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.85 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|