C26H54F2OSiSn — CID 87758729
tert-butyl-[(E,3S)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane (PubChem CID 87758729) has the molecular formula C26H54F2OSiSn and a molecular weight of 567.51 g/mol. Its IUPAC name is tert-butyl-[(E,3S)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3S)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 87758729 |
| Molecular Formula | C26H54F2OSiSn |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | tert-butyl-[(E,3S)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CCCCC(F)(F)[C@H](/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27F2OSi.3C4H9.Sn/c1-8-10-11-14(15,16)12(9-2)17-18(6,7)13(3,4)5;3*1-3-4-2;/h2,9,12H,8,10-11H2,1,3-7H3;3*1,3-4H2,2H3;/t12-;;;;/m0..../s1 |
| InChIKey | RWIPOWXECPFPKK-KCOFNFEMSA-N |
| XLogP | 10.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|