C23H50OSiSn — CID 10601098
tert-butyl-dimethyl-[(E,1S)-1-tributylstannylpent-2-enoxy]silane (PubChem CID 10601098) has the molecular formula C23H50OSiSn and a molecular weight of 489.45 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,1S)-1-tributylstannylpent-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E,1S)-1-tributylstannylpent-2-enoxy]silane |
|---|---|
| PubChem CID | 10601098 |
| Molecular Formula | C23H50OSiSn |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | tert-butyl-dimethyl-[(E,1S)-1-tributylstannylpent-2-enoxy]silane |
| SMILES | CC/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C11H23OSi.3C4H9.Sn/c1-7-8-9-10-12-13(5,6)11(2,3)4;3*1-3-4-2;/h8-10H,7H2,1-6H3;3*1,3-4H2,2H3;/b9-8+;;;; |
| InChIKey | HOSQOIPQYVOTMX-HUMMXKGPSA-N |
| XLogP | 8.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|