C17H34O2Si — CID 10334877
(2E,4S,5S,6E)-4-[tert-butyl(dimethyl)silyl]oxyundeca-2,6-dien-5-ol (PubChem CID 10334877) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (2E,4S,5S,6E)-4-[tert-butyl(dimethyl)silyl]oxyundeca-2,6-dien-5-ol.
| Compound Name | (2E,4S,5S,6E)-4-[tert-butyl(dimethyl)silyl]oxyundeca-2,6-dien-5-ol |
|---|---|
| PubChem CID | 10334877 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (2E,4S,5S,6E)-4-[tert-butyl(dimethyl)silyl]oxyundeca-2,6-dien-5-ol |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/CCCC |
| InChI | InChI=1S/C17H34O2Si/c1-8-10-11-12-14-15(18)16(13-9-2)19-20(6,7)17(3,4)5/h9,12-16,18H,8,10-11H2,1-7H3/b13-9+,14-12+/t15-,16-/m0/s1 |
| InChIKey | ZZRVPEZAELRXKJ-XBLHQLAKSA-N |
| XLogP | 5.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|