C14H28OSi — CID 11615647
tert-butyl-dimethyl-[(1Z,3E)-octa-1,3-dienoxy]silane (PubChem CID 11615647) has the molecular formula C14H28OSi and a molecular weight of 240.46 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1Z,3E)-octa-1,3-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1Z,3E)-octa-1,3-dienoxy]silane |
|---|---|
| PubChem CID | 11615647 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | tert-butyl-dimethyl-[(1Z,3E)-octa-1,3-dienoxy]silane |
| SMILES | CCCC/C=C/C=C\O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28OSi/c1-7-8-9-10-11-12-13-15-16(5,6)14(2,3)4/h10-13H,7-9H2,1-6H3/b11-10+,13-12- |
| InChIKey | QPQBSRAKJPXHSE-MRBUWEIXSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|