C20H40OSi — CID 87835700
tributyl(octa-1,3-dienoxy)silane (PubChem CID 87835700) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is tributyl(octa-1,3-dienoxy)silane.
| Compound Name | tributyl(octa-1,3-dienoxy)silane |
|---|---|
| PubChem CID | 87835700 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | tributyl(octa-1,3-dienoxy)silane |
| SMILES | CCCCC=CC=CO[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C20H40OSi/c1-5-9-13-14-15-16-17-21-22(18-10-6-2,19-11-7-3)20-12-8-4/h14-17H,5-13,18-20H2,1-4H3 |
| InChIKey | VMHCLBUEEZUHSH-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|