C23H46O3Si — CID 153307537
octa-1,3-dienyl(tripentoxy)silane (PubChem CID 153307537) has the molecular formula C23H46O3Si and a molecular weight of 398.70 g/mol. Its IUPAC name is octa-1,3-dienyl(tripentoxy)silane.
| Compound Name | octa-1,3-dienyl(tripentoxy)silane |
|---|---|
| PubChem CID | 153307537 |
| Molecular Formula | C23H46O3Si |
| Molecular Weight | 398.70 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | octa-1,3-dienyl(tripentoxy)silane |
| SMILES | CCCCC=CC=C[Si](OCCCCC)(OCCCCC)OCCCCC |
| InChI | InChI=1S/C23H46O3Si/c1-5-9-13-14-15-19-23-27(24-20-16-10-6-2,25-21-17-11-7-3)26-22-18-12-8-4/h14-15,19,23H,5-13,16-18,20-22H2,1-4H3 |
| InChIKey | XTAXLTQWGRXLNC-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.70 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|