C24H48OSi — CID 173412990
tributyl-[(8E)-dodeca-8,10-dienoxy]silane (PubChem CID 173412990) has the molecular formula C24H48OSi and a molecular weight of 380.73 g/mol. Its IUPAC name is tributyl-[(8E)-dodeca-8,10-dienoxy]silane.
| Compound Name | tributyl-[(8E)-dodeca-8,10-dienoxy]silane |
|---|---|
| PubChem CID | 173412990 |
| Molecular Formula | C24H48OSi |
| Molecular Weight | 380.73 g/mol |
| Exact Mass | 380.35 |
| IUPAC Name | tributyl-[(8E)-dodeca-8,10-dienoxy]silane |
| SMILES | CC=C/C=C/CCCCCCCO[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C24H48OSi/c1-5-9-13-14-15-16-17-18-19-20-21-25-26(22-10-6-2,23-11-7-3)24-12-8-4/h5,9,13-14H,6-8,10-12,15-24H2,1-4H3/b9-5?,14-13+ |
| InChIKey | XALWXYQYMWTCJA-YIYSOGLZSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.73 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|