C17H34OSi — CID 20838897
trimethyl-[(9Z,11E)-tetradeca-9,11-dienoxy]silane (PubChem CID 20838897) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is trimethyl-[(9Z,11E)-tetradeca-9,11-dienoxy]silane.
| Compound Name | trimethyl-[(9Z,11E)-tetradeca-9,11-dienoxy]silane |
|---|---|
| PubChem CID | 20838897 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | trimethyl-[(9Z,11E)-tetradeca-9,11-dienoxy]silane |
| SMILES | CC/C=C/C=C\CCCCCCCCO[Si](C)(C)C |
| InChI | InChI=1S/C17H34OSi/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2,3)4/h6-9H,5,10-17H2,1-4H3/b7-6+,9-8- |
| InChIKey | PXNGSVGFGMWPNX-MUIOLIGRSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|