About triethyl(nona-1,3-dienoxy)silane
triethyl(nona-1,3-dienoxy)silane (PubChem CID 160869571) has the molecular formula C15H30OSi
and a molecular weight of 254.49 g/mol. Its IUPAC name is triethyl(nona-1,3-dienoxy)silane.
Molecular Properties
| Compound Name | triethyl(nona-1,3-dienoxy)silane |
| PubChem CID | 160869571 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | triethyl(nona-1,3-dienoxy)silane |
| SMILES | CCCCCC=CC=CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H30OSi/c1-5-9-10-11-12-13-14-15-16-17(6-2,7-3)8-4/h12-15H,5-11H2,1-4H3 |
| InChIKey | IALRMPYMFUXYOY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze triethyl(nona-1,3-dienoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(nona-1,3-dienoxy)silane?
The IUPAC name of triethyl(nona-1,3-dienoxy)silane (CID 160869571) is triethyl(nona-1,3-dienoxy)silane.
What is the SMILES notation for triethyl(nona-1,3-dienoxy)silane?
The canonical SMILES for triethyl(nona-1,3-dienoxy)silane is CCCCCC=CC=CO[Si](CC)(CC)CC.
What is the InChIKey of triethyl(nona-1,3-dienoxy)silane?
The InChIKey is IALRMPYMFUXYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30OSi/c1-5-9-10-11-12-13-14-15-16-17(6-2,7-3)8-4/h12-15H,5-11H2,1-4H3.
What are the key properties of triethyl(nona-1,3-dienoxy)silane?
triethyl(nona-1,3-dienoxy)silane has a molecular weight of 254.49 g/mol, XLogP of 5.66, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(nona-1,3-dienoxy)silane is sourced from PubChem (CID 160869571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).