About methyl-tris(octa-1,3-dienoxy)silane
methyl-tris(octa-1,3-dienoxy)silane (PubChem CID 87835037) has the molecular formula C25H42O3Si
and a molecular weight of 418.69 g/mol. Its IUPAC name is methyl-tris(octa-1,3-dienoxy)silane.
Molecular Properties
| Compound Name | methyl-tris(octa-1,3-dienoxy)silane |
| PubChem CID | 87835037 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | methyl-tris(octa-1,3-dienoxy)silane |
| SMILES | CCCCC=CC=CO[Si](C)(OC=CC=CCCCC)OC=CC=CCCCC |
| InChI | InChI=1S/C25H42O3Si/c1-5-8-11-14-17-20-23-26-29(4,27-24-21-18-15-12-9-6-2)28-25-22-19-16-13-10-7-3/h14-25H,5-13H2,1-4H3 |
| InChIKey | JIYICLCXTMWXSP-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl-tris(octa-1,3-dienoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-tris(octa-1,3-dienoxy)silane?
The IUPAC name of methyl-tris(octa-1,3-dienoxy)silane (CID 87835037) is methyl-tris(octa-1,3-dienoxy)silane.
What is the SMILES notation for methyl-tris(octa-1,3-dienoxy)silane?
The canonical SMILES for methyl-tris(octa-1,3-dienoxy)silane is CCCCC=CC=CO[Si](C)(OC=CC=CCCCC)OC=CC=CCCCC.
What is the InChIKey of methyl-tris(octa-1,3-dienoxy)silane?
The InChIKey is JIYICLCXTMWXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H42O3Si/c1-5-8-11-14-17-20-23-26-29(4,27-24-21-18-15-12-9-6-2)28-25-22-19-16-13-10-7-3/h14-25H,5-13H2,1-4H3.
What are the key properties of methyl-tris(octa-1,3-dienoxy)silane?
methyl-tris(octa-1,3-dienoxy)silane has a molecular weight of 418.69 g/mol, XLogP of 8.39, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-tris(octa-1,3-dienoxy)silane is sourced from PubChem (CID 87835037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).