C13H22O — CID 12000182
(1Z,3E)-1-(3-methylbut-2-enoxy)octa-1,3-diene (PubChem CID 12000182) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (1Z,3E)-1-(3-methylbut-2-enoxy)octa-1,3-diene.
| Compound Name | (1Z,3E)-1-(3-methylbut-2-enoxy)octa-1,3-diene |
|---|---|
| PubChem CID | 12000182 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (1Z,3E)-1-(3-methylbut-2-enoxy)octa-1,3-diene |
| SMILES | CCCC/C=C/C=C\OCC=C(C)C |
| InChI | InChI=1S/C13H22O/c1-4-5-6-7-8-9-11-14-12-10-13(2)3/h7-11H,4-6,12H2,1-3H3/b8-7+,11-9- |
| InChIKey | NWYSTWDXOOJUSK-OHFYBLQUSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|