C15H24 — CID 173035438
2,3-dimethyltrideca-2,4,6,8-tetraene (PubChem CID 173035438) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 2,3-dimethyltrideca-2,4,6,8-tetraene.
| Compound Name | 2,3-dimethyltrideca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 173035438 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 2,3-dimethyltrideca-2,4,6,8-tetraene |
| SMILES | CCCCC=CC=CC=CC(C)=C(C)C |
| InChI | InChI=1S/C15H24/c1-5-6-7-8-9-10-11-12-13-15(4)14(2)3/h8-13H,5-7H2,1-4H3 |
| InChIKey | UUBKWWBEZOCQKK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|