C23H48O3Si2 — CID 90951994
(5S,6R,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyldeca-2,8-dien-1-ol (PubChem CID 90951994) has the molecular formula C23H48O3Si2 and a molecular weight of 428.81 g/mol. Its IUPAC name is (5S,6R,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyldeca-2,8-dien-1-ol.
| Compound Name | (5S,6R,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyldeca-2,8-dien-1-ol |
|---|---|
| PubChem CID | 90951994 |
| Molecular Formula | C23H48O3Si2 |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (5S,6R,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyldeca-2,8-dien-1-ol |
| SMILES | CC=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](CC=CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O3Si2/c1-13-16-20(25-27(9,10)22(3,4)5)19(2)21(17-14-15-18-24)26-28(11,12)23(6,7)8/h13-16,19-21,24H,17-18H2,1-12H3/t19-,20+,21-/m0/s1 |
| InChIKey | YPEPYFDZOOBHAY-HBMCJLEFSA-N |
| XLogP | 6.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|