C15H29IO2Si — CID 159080452
(2E,5S,6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-8-iodo-5-methylocta-2,7-dien-1-ol (PubChem CID 159080452) has the molecular formula C15H29IO2Si and a molecular weight of 396.39 g/mol. Its IUPAC name is (2E,5S,6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-8-iodo-5-methylocta-2,7-dien-1-ol.
| Compound Name | (2E,5S,6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-8-iodo-5-methylocta-2,7-dien-1-ol |
|---|---|
| PubChem CID | 159080452 |
| Molecular Formula | C15H29IO2Si |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (2E,5S,6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-8-iodo-5-methylocta-2,7-dien-1-ol |
| SMILES | C[C@@H](C/C=C/CO)[C@@H](/C=C\I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29IO2Si/c1-13(9-7-8-12-17)14(10-11-16)18-19(5,6)15(2,3)4/h7-8,10-11,13-14,17H,9,12H2,1-6H3/b8-7+,11-10-/t13-,14+/m0/s1 |
| InChIKey | HSQGWCMBAILYAY-COTSRKQWSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|