C31H40O3Si — CID 135015770
(Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-trityloxyhex-2-en-1-ol (PubChem CID 135015770) has the molecular formula C31H40O3Si and a molecular weight of 488.74 g/mol. Its IUPAC name is (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-trityloxyhex-2-en-1-ol.
| Compound Name | (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-trityloxyhex-2-en-1-ol |
|---|---|
| PubChem CID | 135015770 |
| Molecular Formula | C31H40O3Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-trityloxyhex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C/C=C\CO)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40O3Si/c1-30(2,3)35(4,5)34-29(23-15-16-24-32)25-33-31(26-17-9-6-10-18-26,27-19-11-7-12-20-27)28-21-13-8-14-22-28/h6-22,29,32H,23-25H2,1-5H3/b16-15-/t29-/m1/s1 |
| InChIKey | BNOVLWZZLBFGDC-CPWWBXQMSA-N |
| XLogP | 7.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|