C38H58O9S2Si2 — CID 10865636
[(2S,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylsulfonyloxy-5-trityloxypentyl] methanesulfonate (PubChem CID 10865636) has the molecular formula C38H58O9S2Si2 and a molecular weight of 779.18 g/mol. Its IUPAC name is [(2S,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylsulfonyloxy-5-trityloxypentyl] methanesulfonate.
| Compound Name | [(2S,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylsulfonyloxy-5-trityloxypentyl] methanesulfonate |
|---|---|
| PubChem CID | 10865636 |
| Molecular Formula | C38H58O9S2Si2 |
| Molecular Weight | 779.18 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | [(2S,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylsulfonyloxy-5-trityloxypentyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]([C@H](COS(C)(=O)=O)O[Si](C)(C)C(C)(C)C)[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C38H58O9S2Si2/c1-36(2,3)50(9,10)46-34(29-44-48(7,39)40)35(47-51(11,12)37(4,5)6)33(45-49(8,41)42)28-43-38(30-22-16-13-17-23-30,31-24-18-14-19-25-31)32-26-20-15-21-27-32/h13-27,33-35H,28-29H2,1-12H3/t33-,34-,35-/m0/s1 |
| InChIKey | RIBUKJKDJRCBEF-IMKBVMFZSA-N |
| XLogP | 8.10 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.18 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|