C27H32O9S2 — CID 57300721
2-hydroxy-4-(2-methylsulfonyloxyethoxy)-5-trityloxypentane-1-sulfonic acid (PubChem CID 57300721) has the molecular formula C27H32O9S2 and a molecular weight of 564.68 g/mol. Its IUPAC name is 2-hydroxy-4-(2-methylsulfonyloxyethoxy)-5-trityloxypentane-1-sulfonic acid.
| Compound Name | 2-hydroxy-4-(2-methylsulfonyloxyethoxy)-5-trityloxypentane-1-sulfonic acid |
|---|---|
| PubChem CID | 57300721 |
| Molecular Formula | C27H32O9S2 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 2-hydroxy-4-(2-methylsulfonyloxyethoxy)-5-trityloxypentane-1-sulfonic acid |
| SMILES | CS(=O)(=O)OCCOC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C27H32O9S2/c1-37(29,30)36-18-17-34-26(19-25(28)21-38(31,32)33)20-35-27(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-16,25-26,28H,17-21H2,1H3,(H,31,32,33) |
| InChIKey | CCDZPPPEYUBFPI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|